C13H20F2N2O — CID 103150047
3-(2,2-difluoroethoxy)-N-propyl-1-pyridin-3-ylpropan-1-amine (PubChem CID 103150047) has the molecular formula C13H20F2N2O and a molecular weight of 258.31 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-propyl-1-pyridin-3-ylpropan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-N-propyl-1-pyridin-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 103150047 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-propyl-1-pyridin-3-ylpropan-1-amine |
| SMILES | CCCNC(CCOCC(F)F)c1cccnc1 |
| InChI | InChI=1S/C13H20F2N2O/c1-2-6-17-12(5-8-18-10-13(14)15)11-4-3-7-16-9-11/h3-4,7,9,12-13,17H,2,5-6,8,10H2,1H3 |
| InChIKey | INFFROTUICUXKW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|