C13H20N2O4S — CID 71083907
pyridin-3-ylmethyl N-(2-butylsulfonylethyl)carbamate (PubChem CID 71083907) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-(2-butylsulfonylethyl)carbamate.
| Compound Name | pyridin-3-ylmethyl N-(2-butylsulfonylethyl)carbamate |
|---|---|
| PubChem CID | 71083907 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | pyridin-3-ylmethyl N-(2-butylsulfonylethyl)carbamate |
| SMILES | CCCCS(=O)(=O)CCNC(=O)OCc1cccnc1 |
| InChI | InChI=1S/C13H20N2O4S/c1-2-3-8-20(17,18)9-7-15-13(16)19-11-12-5-4-6-14-10-12/h4-6,10H,2-3,7-9,11H2,1H3,(H,15,16) |
| InChIKey | NFVXWIXCZHOXTH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |