C15H23BrO3 — CID 98134144
[(1R,4R,5R,8R,9R)-4-(bromomethyl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl acetate (PubChem CID 98134144) has the molecular formula C15H23BrO3 and a molecular weight of 331.25 g/mol. Its IUPAC name is [(1R,4R,5R,8R,9R)-4-(bromomethyl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl acetate.
| Compound Name | [(1R,4R,5R,8R,9R)-4-(bromomethyl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 98134144 |
| Molecular Formula | C15H23BrO3 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | [(1R,4R,5R,8R,9R)-4-(bromomethyl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CO[C@@H](CBr)[C@@H](C(C)=C[C@H]1C)[C@H]2C |
| InChI | InChI=1S/C15H23BrO3/c1-9-5-10(2)15(7-18-12(4)17)8-19-13(6-16)14(9)11(15)3/h5,10-11,13-14H,6-8H2,1-4H3/t10-,11-,13+,14+,15+/m1/s1 |
| InChIKey | GNKKJKBUVIYTBC-MFHWUAJNSA-N |
| XLogP | 3.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|