C16H22O — CID 134861940
(2R,7S)-4,7-dimethyl-2-(2-phenylethyl)-2,3,6,7-tetrahydrooxepine (PubChem CID 134861940) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (2R,7S)-4,7-dimethyl-2-(2-phenylethyl)-2,3,6,7-tetrahydrooxepine.
| Compound Name | (2R,7S)-4,7-dimethyl-2-(2-phenylethyl)-2,3,6,7-tetrahydrooxepine |
|---|---|
| PubChem CID | 134861940 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (2R,7S)-4,7-dimethyl-2-(2-phenylethyl)-2,3,6,7-tetrahydrooxepine |
| SMILES | CC1=CC[C@H](C)O[C@H](CCc2ccccc2)C1 |
| InChI | InChI=1S/C16H22O/c1-13-8-9-14(2)17-16(12-13)11-10-15-6-4-3-5-7-15/h3-8,14,16H,9-12H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | BXPZHDSAAYGGRL-GOEBONIOSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|