About CID 23340127
CID 23340127 (PubChem CID 23340127) has the molecular formula C14H14O6P2Pb-4
and a molecular weight of 547.41 g/mol.
Molecular Properties
| Compound Name | CID 23340127 |
| PubChem CID | 23340127 |
| Molecular Formula | C14H14O6P2Pb-4 |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | — |
| SMILES | O=P([O-])([O-])Cc1ccccc1.O=P([O-])([O-])Cc1ccccc1.[Pb] |
| InChI | InChI=1S/2C7H9O3P.Pb/c2*8-11(9,10)6-7-4-2-1-3-5-7;/h2*1-5H,6H2,(H2,8,9,10);/p-4 |
| InChIKey | UZTWIOOPJCRLCF-UHFFFAOYSA-J |
| XLogP | -0.18 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 23340127 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23340127?
The IUPAC name of CID 23340127 (CID 23340127) is not available.
What is the SMILES notation for CID 23340127?
The canonical SMILES for CID 23340127 is O=P([O-])([O-])Cc1ccccc1.O=P([O-])([O-])Cc1ccccc1.[Pb].
What is the InChIKey of CID 23340127?
The InChIKey is UZTWIOOPJCRLCF-UHFFFAOYSA-J. The full InChI is InChI=1S/2C7H9O3P.Pb/c2*8-11(9,10)6-7-4-2-1-3-5-7;/h2*1-5H,6H2,(H2,8,9,10);/p-4.
What are the key properties of CID 23340127?
CID 23340127 has a molecular weight of 547.41 g/mol, XLogP of -0.18, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23340127 is sourced from PubChem (CID 23340127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).