About di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane
di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane (PubChem CID 102245857) has the molecular formula C16H15PS
and a molecular weight of 270.34 g/mol. Its IUPAC name is di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane |
| PubChem CID | 102245857 |
| Molecular Formula | C16H15PS |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane |
| SMILES | S=P(c1ccccc1)(C1C=CC=C1)C1C=CC=C1 |
| InChI | InChI=1S/C16H15PS/c18-17(15-10-4-5-11-15,16-12-6-7-13-16)14-8-2-1-3-9-14/h1-13,15-16H |
| InChIKey | PCDJAYMJPMMMHV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane?
The IUPAC name of di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane (CID 102245857) is di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane.
What is the SMILES notation for di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane?
The canonical SMILES for di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane is S=P(c1ccccc1)(C1C=CC=C1)C1C=CC=C1.
What is the InChIKey of di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane?
The InChIKey is PCDJAYMJPMMMHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15PS/c18-17(15-10-4-5-11-15,16-12-6-7-13-16)14-8-2-1-3-9-14/h1-13,15-16H.
What are the key properties of di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane?
di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane has a molecular weight of 270.34 g/mol, XLogP of 3.78, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 102245857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).