C16H15PS — CID 102245857
di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane (PubChem CID 102245857) has the molecular formula C16H15PS and a molecular weight of 270.34 g/mol. Its IUPAC name is di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane.
| Compound Name | di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 102245857 |
| Molecular Formula | C16H15PS |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | di(cyclopenta-2,4-dien-1-yl)-phenyl-sulfanylidene-λ5-phosphane |
| SMILES | S=P(c1ccccc1)(C1C=CC=C1)C1C=CC=C1 |
| InChI | InChI=1S/C16H15PS/c18-17(15-10-4-5-11-15,16-12-6-7-13-16)14-8-2-1-3-9-14/h1-13,15-16H |
| InChIKey | PCDJAYMJPMMMHV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|