C25H38N2O+2 — CID 7071028
2-[(2R,4R,5S)-4-benzyl-1,2,5-trimethylpiperidin-1-ium-4-yl]ethyl-[(4-methoxyphenyl)methyl]azanium (PubChem CID 7071028) has the molecular formula C25H38N2O+2 and a molecular weight of 382.59 g/mol. Its IUPAC name is 2-[(2R,4R,5S)-4-benzyl-1,2,5-trimethylpiperidin-1-ium-4-yl]ethyl-[(4-methoxyphenyl)methyl]azanium.
| Compound Name | 2-[(2R,4R,5S)-4-benzyl-1,2,5-trimethylpiperidin-1-ium-4-yl]ethyl-[(4-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7071028 |
| Molecular Formula | C25H38N2O+2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.30 |
| IUPAC Name | 2-[(2R,4R,5S)-4-benzyl-1,2,5-trimethylpiperidin-1-ium-4-yl]ethyl-[(4-methoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH2+]CC[C@]2(Cc3ccccc3)C[C@@H](C)[NH+](C)C[C@H]2C)cc1 |
| InChI | InChI=1S/C25H36N2O/c1-20-19-27(3)21(2)16-25(20,17-22-8-6-5-7-9-22)14-15-26-18-23-10-12-24(28-4)13-11-23/h5-13,20-21,26H,14-19H2,1-4H3/p+2/t20-,21-,25-/m1/s1 |
| InChIKey | BWDBVIZIEPZRRP-DNRQZRRGSA-P |
| XLogP | 2.32 |
| TPSA | 30.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|