C24H34NO2+ — CID 7077030
[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]-[(4-methoxyphenyl)methyl]azanium (PubChem CID 7077030) has the molecular formula C24H34NO2+ and a molecular weight of 368.54 g/mol. Its IUPAC name is [(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]-[(4-methoxyphenyl)methyl]azanium.
| Compound Name | [(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]-[(4-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7077030 |
| Molecular Formula | C24H34NO2+ |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | [(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]-[(4-methoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH2+]CC[C@H](c2ccccc2)[C@@H]2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C24H33NO2/c1-24(2)17-21(14-16-27-24)23(20-7-5-4-6-8-20)13-15-25-18-19-9-11-22(26-3)12-10-19/h4-12,21,23,25H,13-18H2,1-3H3/p+1/t21-,23-/m1/s1 |
| InChIKey | HBNBFAARFWTUME-FYYLOGMGSA-O |
| XLogP | 4.14 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|