C25H35NO3 — CID 7076924
(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-methoxyphenyl)-N-[(4-methoxyphenyl)methyl]propan-1-amine (PubChem CID 7076924) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is (3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-methoxyphenyl)-N-[(4-methoxyphenyl)methyl]propan-1-amine.
| Compound Name | (3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-methoxyphenyl)-N-[(4-methoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 7076924 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | (3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-methoxyphenyl)-N-[(4-methoxyphenyl)methyl]propan-1-amine |
| SMILES | COc1ccc(CNCC[C@@H](c2ccc(OC)cc2)[C@H]2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C25H35NO3/c1-25(2)17-21(14-16-29-25)24(20-7-11-23(28-4)12-8-20)13-15-26-18-19-5-9-22(27-3)10-6-19/h5-12,21,24,26H,13-18H2,1-4H3/t21-,24-/m0/s1 |
| InChIKey | UVKDIUMGVALWFS-URXFXBBRSA-N |
| XLogP | 5.17 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|