C26H38N2O — CID 2172874
4-[[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-methylphenyl)propyl]amino]methyl]-N,N-dimethylaniline (PubChem CID 2172874) has the molecular formula C26H38N2O and a molecular weight of 394.60 g/mol. Its IUPAC name is 4-[[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-methylphenyl)propyl]amino]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-methylphenyl)propyl]amino]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 2172874 |
| Molecular Formula | C26H38N2O |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | 4-[[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-methylphenyl)propyl]amino]methyl]-N,N-dimethylaniline |
| SMILES | Cc1ccc([C@@H](CCNCc2ccc(N(C)C)cc2)[C@@H]2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C26H38N2O/c1-20-6-10-22(11-7-20)25(23-15-17-29-26(2,3)18-23)14-16-27-19-21-8-12-24(13-9-21)28(4)5/h6-13,23,25,27H,14-19H2,1-5H3/t23-,25-/m1/s1 |
| InChIKey | ILKGFZGCTFIHGF-ILBGXUMGSA-N |
| XLogP | 5.53 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|