C25H36N2O — CID 7110204
4-[[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]amino]methyl]-N,N-dimethylaniline (PubChem CID 7110204) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is 4-[[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]amino]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]amino]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 7110204 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | 4-[[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]amino]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(CNCC[C@@H](c2ccccc2)[C@H]2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C25H36N2O/c1-25(2)18-22(15-17-28-25)24(21-8-6-5-7-9-21)14-16-26-19-20-10-12-23(13-11-20)27(3)4/h5-13,22,24,26H,14-19H2,1-4H3/t22-,24-/m0/s1 |
| InChIKey | QAEVRHQHJWNQEI-UPVQGACJSA-N |
| XLogP | 5.22 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|