C25H36NO3+ — CID 7077135
[(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(2-methoxyphenyl)propyl]-[(4-methoxyphenyl)methyl]azanium (PubChem CID 7077135) has the molecular formula C25H36NO3+ and a molecular weight of 398.57 g/mol. Its IUPAC name is [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(2-methoxyphenyl)propyl]-[(4-methoxyphenyl)methyl]azanium.
| Compound Name | [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(2-methoxyphenyl)propyl]-[(4-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7077135 |
| Molecular Formula | C25H36NO3+ |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(2-methoxyphenyl)propyl]-[(4-methoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH2+]CC[C@@H](c2ccccc2OC)[C@@H]2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C25H35NO3/c1-25(2)17-20(14-16-29-25)22(23-7-5-6-8-24(23)28-4)13-15-26-18-19-9-11-21(27-3)12-10-19/h5-12,20,22,26H,13-18H2,1-4H3/p+1/t20-,22-/m1/s1 |
| InChIKey | DBOUKUPGIYVACZ-IFMALSPDSA-O |
| XLogP | 4.15 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|