C17H28NO2+ — CID 4265463
2-(2,2-dimethyloxan-4-yl)ethyl-[(4-methoxyphenyl)methyl]azanium (PubChem CID 4265463) has the molecular formula C17H28NO2+ and a molecular weight of 278.42 g/mol. Its IUPAC name is 2-(2,2-dimethyloxan-4-yl)ethyl-[(4-methoxyphenyl)methyl]azanium.
| Compound Name | 2-(2,2-dimethyloxan-4-yl)ethyl-[(4-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 4265463 |
| Molecular Formula | C17H28NO2+ |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-(2,2-dimethyloxan-4-yl)ethyl-[(4-methoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH2+]CCC2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C17H27NO2/c1-17(2)12-14(9-11-20-17)8-10-18-13-15-4-6-16(19-3)7-5-15/h4-7,14,18H,8-13H2,1-3H3/p+1 |
| InChIKey | LGVHUYKGQMFWRQ-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|