C24H42NO2+ — CID 7088544
2-[(4R)-2,2-dimethyl-4-(3-methylbutyl)oxan-4-yl]ethyl-[(4-propan-2-yloxyphenyl)methyl]azanium (PubChem CID 7088544) has the molecular formula C24H42NO2+ and a molecular weight of 376.61 g/mol. Its IUPAC name is 2-[(4R)-2,2-dimethyl-4-(3-methylbutyl)oxan-4-yl]ethyl-[(4-propan-2-yloxyphenyl)methyl]azanium.
| Compound Name | 2-[(4R)-2,2-dimethyl-4-(3-methylbutyl)oxan-4-yl]ethyl-[(4-propan-2-yloxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7088544 |
| Molecular Formula | C24H42NO2+ |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.32 |
| IUPAC Name | 2-[(4R)-2,2-dimethyl-4-(3-methylbutyl)oxan-4-yl]ethyl-[(4-propan-2-yloxyphenyl)methyl]azanium |
| SMILES | CC(C)CC[C@@]1(CC[NH2+]Cc2ccc(OC(C)C)cc2)CCOC(C)(C)C1 |
| InChI | InChI=1S/C24H41NO2/c1-19(2)11-12-24(14-16-26-23(5,6)18-24)13-15-25-17-21-7-9-22(10-8-21)27-20(3)4/h7-10,19-20,25H,11-18H2,1-6H3/p+1/t24-/m1/s1 |
| InChIKey | XIPHEVSTVZMQGN-XMMPIXPASA-O |
| XLogP | 4.94 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|