C17H28NO4+ — CID 4979378
2-(4-hydroxy-2,2-dimethyloxan-4-yl)ethyl-[(4-hydroxy-3-methoxyphenyl)methyl]azanium (PubChem CID 4979378) has the molecular formula C17H28NO4+ and a molecular weight of 310.41 g/mol. Its IUPAC name is 2-(4-hydroxy-2,2-dimethyloxan-4-yl)ethyl-[(4-hydroxy-3-methoxyphenyl)methyl]azanium.
| Compound Name | 2-(4-hydroxy-2,2-dimethyloxan-4-yl)ethyl-[(4-hydroxy-3-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 4979378 |
| Molecular Formula | C17H28NO4+ |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 2-(4-hydroxy-2,2-dimethyloxan-4-yl)ethyl-[(4-hydroxy-3-methoxyphenyl)methyl]azanium |
| SMILES | COc1cc(C[NH2+]CCC2(O)CCOC(C)(C)C2)ccc1O |
| InChI | InChI=1S/C17H27NO4/c1-16(2)12-17(20,7-9-22-16)6-8-18-11-13-4-5-14(19)15(10-13)21-3/h4-5,10,18-20H,6-9,11-12H2,1-3H3/p+1 |
| InChIKey | AIWKOVBKHMBFLM-UHFFFAOYSA-O |
| XLogP | 1.17 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|