C23H32NO3+ — CID 7076776
2-[(4R)-2,2-dimethyl-4-phenyloxan-4-yl]ethyl-[(4-hydroxy-3-methoxyphenyl)methyl]azanium (PubChem CID 7076776) has the molecular formula C23H32NO3+ and a molecular weight of 370.51 g/mol. Its IUPAC name is 2-[(4R)-2,2-dimethyl-4-phenyloxan-4-yl]ethyl-[(4-hydroxy-3-methoxyphenyl)methyl]azanium.
| Compound Name | 2-[(4R)-2,2-dimethyl-4-phenyloxan-4-yl]ethyl-[(4-hydroxy-3-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7076776 |
| Molecular Formula | C23H32NO3+ |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 2-[(4R)-2,2-dimethyl-4-phenyloxan-4-yl]ethyl-[(4-hydroxy-3-methoxyphenyl)methyl]azanium |
| SMILES | COc1cc(C[NH2+]CC[C@@]2(c3ccccc3)CCOC(C)(C)C2)ccc1O |
| InChI | InChI=1S/C23H31NO3/c1-22(2)17-23(12-14-27-22,19-7-5-4-6-8-19)11-13-24-16-18-9-10-20(25)21(15-18)26-3/h4-10,15,24-25H,11-14,16-17H2,1-3H3/p+1/t23-/m1/s1 |
| InChIKey | BTRKQQZHDJJSEA-HSZRJFAPSA-O |
| XLogP | 3.38 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|