C23H31FNO2+ — CID 7118786
2-[(2S,4S)-2-ethyl-4-(4-fluorophenyl)-2-methyloxan-4-yl]ethyl-[(2-hydroxyphenyl)methyl]azanium (PubChem CID 7118786) has the molecular formula C23H31FNO2+ and a molecular weight of 372.50 g/mol. Its IUPAC name is 2-[(2S,4S)-2-ethyl-4-(4-fluorophenyl)-2-methyloxan-4-yl]ethyl-[(2-hydroxyphenyl)methyl]azanium.
| Compound Name | 2-[(2S,4S)-2-ethyl-4-(4-fluorophenyl)-2-methyloxan-4-yl]ethyl-[(2-hydroxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7118786 |
| Molecular Formula | C23H31FNO2+ |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 2-[(2S,4S)-2-ethyl-4-(4-fluorophenyl)-2-methyloxan-4-yl]ethyl-[(2-hydroxyphenyl)methyl]azanium |
| SMILES | CC[C@@]1(C)C[C@@](CC[NH2+]Cc2ccccc2O)(c2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C23H30FNO2/c1-3-22(2)17-23(13-15-27-22,19-8-10-20(24)11-9-19)12-14-25-16-18-6-4-5-7-21(18)26/h4-11,25-26H,3,12-17H2,1-2H3/p+1/t22-,23-/m0/s1 |
| InChIKey | GNRUCBIEUBRFDK-GOTSBHOMSA-O |
| XLogP | 3.90 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|