C24H33FNO+ — CID 7098347
2-[(2R,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]ethyl-[(4-fluorophenyl)methyl]azanium (PubChem CID 7098347) has the molecular formula C24H33FNO+ and a molecular weight of 370.53 g/mol. Its IUPAC name is 2-[(2R,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]ethyl-[(4-fluorophenyl)methyl]azanium.
| Compound Name | 2-[(2R,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]ethyl-[(4-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 7098347 |
| Molecular Formula | C24H33FNO+ |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 2-[(2R,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]ethyl-[(4-fluorophenyl)methyl]azanium |
| SMILES | CC[C@]1(C)C[C@@](CC[NH2+]Cc2ccc(F)cc2)(c2ccc(C)cc2)CCO1 |
| InChI | InChI=1S/C24H32FNO/c1-4-23(3)18-24(14-16-27-23,21-9-5-19(2)6-10-21)13-15-26-17-20-7-11-22(25)12-8-20/h5-12,26H,4,13-18H2,1-3H3/p+1/t23-,24+/m1/s1 |
| InChIKey | RIFBHJUQIDTORA-RPWUZVMVSA-O |
| XLogP | 4.50 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|