C23H29F2NO — CID 3132849
2-[2-ethyl-4-(4-fluorophenyl)-2-methyloxan-4-yl]-N-[(4-fluorophenyl)methyl]ethanamine (PubChem CID 3132849) has the molecular formula C23H29F2NO and a molecular weight of 373.49 g/mol. Its IUPAC name is 2-[2-ethyl-4-(4-fluorophenyl)-2-methyloxan-4-yl]-N-[(4-fluorophenyl)methyl]ethanamine.
| Compound Name | 2-[2-ethyl-4-(4-fluorophenyl)-2-methyloxan-4-yl]-N-[(4-fluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 3132849 |
| Molecular Formula | C23H29F2NO |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 2-[2-ethyl-4-(4-fluorophenyl)-2-methyloxan-4-yl]-N-[(4-fluorophenyl)methyl]ethanamine |
| SMILES | CCC1(C)CC(CCNCc2ccc(F)cc2)(c2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C23H29F2NO/c1-3-22(2)17-23(13-15-27-22,19-6-10-21(25)11-7-19)12-14-26-16-18-4-8-20(24)9-5-18/h4-11,26H,3,12-17H2,1-2H3 |
| InChIKey | DBJXADIIVXDBFH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|