C23H30FNO2 — CID 129158644
2-[(9R)-9-(4-fluorophenyl)-6-oxaspiro[4.5]decan-9-yl]-N-[(5-methylfuran-2-yl)methyl]ethanamine (PubChem CID 129158644) has the molecular formula C23H30FNO2 and a molecular weight of 371.50 g/mol. Its IUPAC name is 2-[(9R)-9-(4-fluorophenyl)-6-oxaspiro[4.5]decan-9-yl]-N-[(5-methylfuran-2-yl)methyl]ethanamine.
| Compound Name | 2-[(9R)-9-(4-fluorophenyl)-6-oxaspiro[4.5]decan-9-yl]-N-[(5-methylfuran-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 129158644 |
| Molecular Formula | C23H30FNO2 |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 2-[(9R)-9-(4-fluorophenyl)-6-oxaspiro[4.5]decan-9-yl]-N-[(5-methylfuran-2-yl)methyl]ethanamine |
| SMILES | Cc1ccc(CNCC[C@@]2(c3ccc(F)cc3)CCOC3(CCCC3)C2)o1 |
| InChI | InChI=1S/C23H30FNO2/c1-18-4-9-21(27-18)16-25-14-12-22(19-5-7-20(24)8-6-19)13-15-26-23(17-22)10-2-3-11-23/h4-9,25H,2-3,10-17H2,1H3/t22-/m1/s1 |
| InChIKey | OYZMJCMSSUJIHA-JOCHJYFZSA-N |
| XLogP | 5.27 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|