C23H28F2N2O — CID 129158672
N-[(2,6-difluorophenyl)methyl]-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine (PubChem CID 129158672) has the molecular formula C23H28F2N2O and a molecular weight of 386.49 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methyl]-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine.
| Compound Name | N-[(2,6-difluorophenyl)methyl]-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine |
|---|---|
| PubChem CID | 129158672 |
| Molecular Formula | C23H28F2N2O |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine |
| SMILES | Fc1cccc(F)c1CNCC[C@@]1(c2ccccn2)CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C23H28F2N2O/c24-19-6-5-7-20(25)18(19)16-26-14-11-22(21-8-1-4-13-27-21)12-15-28-23(17-22)9-2-3-10-23/h1,4-8,13,26H,2-3,9-12,14-17H2/t22-/m1/s1 |
| InChIKey | CTEMWEXYBBTCNY-JOCHJYFZSA-N |
| XLogP | 4.90 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|