C23H28F3N3O — CID 129158750
2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]-N-[[5-(trifluoromethyl)-3-pyridinyl]methyl]ethanamine (PubChem CID 129158750) has the molecular formula C23H28F3N3O and a molecular weight of 419.49 g/mol. Its IUPAC name is 2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]-N-[[5-(trifluoromethyl)-3-pyridinyl]methyl]ethanamine.
| Compound Name | 2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]-N-[[5-(trifluoromethyl)-3-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 129158750 |
| Molecular Formula | C23H28F3N3O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]-N-[[5-(trifluoromethyl)-3-pyridinyl]methyl]ethanamine |
| SMILES | FC(F)(F)c1cncc(CNCC[C@@]2(c3ccccn3)CCOC3(CCCC3)C2)c1 |
| InChI | InChI=1S/C23H28F3N3O/c24-23(25,26)19-13-18(15-28-16-19)14-27-11-8-21(20-5-1-4-10-29-20)9-12-30-22(17-21)6-2-3-7-22/h1,4-5,10,13,15-16,27H,2-3,6-9,11-12,14,17H2/t21-/m1/s1 |
| InChIKey | AWPAYYHNAYJFRU-OAQYLSRUSA-N |
| XLogP | 5.04 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|