C22H27BrFN3O — CID 123264481
N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-2-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)ethanamine (PubChem CID 123264481) has the molecular formula C22H27BrFN3O and a molecular weight of 448.38 g/mol. Its IUPAC name is N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-2-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)ethanamine.
| Compound Name | N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-2-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)ethanamine |
|---|---|
| PubChem CID | 123264481 |
| Molecular Formula | C22H27BrFN3O |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-2-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)ethanamine |
| SMILES | Fc1cc(CNCCC2(c3ccccn3)CCOC3(CCCC3)C2)cnc1Br |
| InChI | InChI=1S/C22H27BrFN3O/c23-20-18(24)13-17(15-27-20)14-25-11-8-21(19-5-1-4-10-26-19)9-12-28-22(16-21)6-2-3-7-22/h1,4-5,10,13,15,25H,2-3,6-9,11-12,14,16H2 |
| InChIKey | GAQNNWRKOXJSTF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|