C24H30F3N3O3 — CID 72712364
N-(pyridin-3-ylmethyl)-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine;2,2,2-trifluoroacetic acid (PubChem CID 72712364) has the molecular formula C24H30F3N3O3 and a molecular weight of 465.52 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-(pyridin-3-ylmethyl)-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 72712364 |
| Molecular Formula | C24H30F3N3O3 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ccc([C@]2(CCNCc3cccnc3)CCOC3(CCCC3)C2)nc1 |
| InChI | InChI=1S/C22H29N3O.C2HF3O2/c1-4-13-25-20(7-1)21(10-14-24-17-19-6-5-12-23-16-19)11-15-26-22(18-21)8-2-3-9-22;3-2(4,5)1(6)7/h1,4-7,12-13,16,24H,2-3,8-11,14-15,17-18H2;(H,6,7)/t21-;/m1./s1 |
| InChIKey | BTTURBVUYHPNNG-ZMBIFBSDSA-N |
| XLogP | 4.65 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|