C24H29F3N2O — CID 129158559
2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine (PubChem CID 129158559) has the molecular formula C24H29F3N2O and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine.
| Compound Name | 2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 129158559 |
| Molecular Formula | C24H29F3N2O |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine |
| SMILES | FC(F)(F)c1cccc(CNCC[C@@]2(c3ccccn3)CCOC3(CCCC3)C2)c1 |
| InChI | InChI=1S/C24H29F3N2O/c25-24(26,27)20-7-5-6-19(16-20)17-28-14-11-22(21-8-1-4-13-29-21)12-15-30-23(18-22)9-2-3-10-23/h1,4-8,13,16,28H,2-3,9-12,14-15,17-18H2/t22-/m1/s1 |
| InChIKey | JTGPPKNPUFOTGW-JOCHJYFZSA-N |
| XLogP | 5.64 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|