C24H35F3N2O3 — CID 72712591
N-(cyclopentylmethyl)-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine;2,2,2-trifluoroacetic acid (PubChem CID 72712591) has the molecular formula C24H35F3N2O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-(cyclopentylmethyl)-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 72712591 |
| Molecular Formula | C24H35F3N2O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | N-(cyclopentylmethyl)-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ccc([C@]2(CCNCC3CCCC3)CCOC3(CCCC3)C2)nc1 |
| InChI | InChI=1S/C22H34N2O.C2HF3O2/c1-2-8-19(7-1)17-23-15-12-21(20-9-3-6-14-24-20)13-16-25-22(18-21)10-4-5-11-22;3-2(4,5)1(6)7/h3,6,9,14,19,23H,1-2,4-5,7-8,10-13,15-18H2;(H,6,7)/t21-;/m1./s1 |
| InChIKey | DZEOTDKHTONTMF-ZMBIFBSDSA-N |
| XLogP | 5.25 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|