C25H34FNO3 — CID 7369228
N-[(3,4-dimethoxyphenyl)methyl]-2-[(2R,4S)-2-ethyl-4-(4-fluorophenyl)-2-methyloxan-4-yl]ethanamine (PubChem CID 7369228) has the molecular formula C25H34FNO3 and a molecular weight of 415.55 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-[(2R,4S)-2-ethyl-4-(4-fluorophenyl)-2-methyloxan-4-yl]ethanamine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[(2R,4S)-2-ethyl-4-(4-fluorophenyl)-2-methyloxan-4-yl]ethanamine |
|---|---|
| PubChem CID | 7369228 |
| Molecular Formula | C25H34FNO3 |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[(2R,4S)-2-ethyl-4-(4-fluorophenyl)-2-methyloxan-4-yl]ethanamine |
| SMILES | CC[C@]1(C)C[C@@](CCNCc2ccc(OC)c(OC)c2)(c2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C25H34FNO3/c1-5-24(2)18-25(13-15-30-24,20-7-9-21(26)10-8-20)12-14-27-17-19-6-11-22(28-3)23(16-19)29-4/h6-11,16,27H,5,12-15,17-18H2,1-4H3/t24-,25+/m1/s1 |
| InChIKey | DRZWIKQELHNHHQ-RPBOFIJWSA-N |
| XLogP | 5.24 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|