C26H37NO2 — CID 59163277
N-[(3,4-dimethoxyphenyl)methyl]-2-[3,3-dimethyl-1-(4-methylphenyl)cyclohexyl]ethanamine (PubChem CID 59163277) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-[3,3-dimethyl-1-(4-methylphenyl)cyclohexyl]ethanamine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[3,3-dimethyl-1-(4-methylphenyl)cyclohexyl]ethanamine |
|---|---|
| PubChem CID | 59163277 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[3,3-dimethyl-1-(4-methylphenyl)cyclohexyl]ethanamine |
| SMILES | COc1ccc(CNCCC2(c3ccc(C)cc3)CCCC(C)(C)C2)cc1OC |
| InChI | InChI=1S/C26H37NO2/c1-20-7-10-22(11-8-20)26(14-6-13-25(2,3)19-26)15-16-27-18-21-9-12-23(28-4)24(17-21)29-5/h7-12,17,27H,6,13-16,18-19H2,1-5H3 |
| InChIKey | HRBMHARTOHHRFQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|