C24H31NO4 — CID 39378245
N-(1,3-benzodioxol-5-ylmethyl)-2-[(4S)-4-(4-methoxyphenyl)-2,2-dimethyloxan-4-yl]ethanamine (PubChem CID 39378245) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[(4S)-4-(4-methoxyphenyl)-2,2-dimethyloxan-4-yl]ethanamine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(4S)-4-(4-methoxyphenyl)-2,2-dimethyloxan-4-yl]ethanamine |
|---|---|
| PubChem CID | 39378245 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(4S)-4-(4-methoxyphenyl)-2,2-dimethyloxan-4-yl]ethanamine |
| SMILES | COc1ccc([C@@]2(CCNCc3ccc4c(c3)OCO4)CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C24H31NO4/c1-23(2)16-24(11-13-29-23,19-5-7-20(26-3)8-6-19)10-12-25-15-18-4-9-21-22(14-18)28-17-27-21/h4-9,14,25H,10-13,15-17H2,1-3H3/t24-/m0/s1 |
| InChIKey | PMHNCLPUURWNGN-DEOSSOPVSA-N |
| XLogP | 4.43 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|