C24H28F3NO3 — CID 41076145
N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine (PubChem CID 41076145) has the molecular formula C24H28F3NO3 and a molecular weight of 435.49 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine |
|---|---|
| PubChem CID | 41076145 |
| Molecular Formula | C24H28F3NO3 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine |
| SMILES | CC1(C)C[C@](CCNCc2ccc3c(c2)OCO3)(c2cccc(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C24H28F3NO3/c1-22(2)15-23(9-11-31-22,18-4-3-5-19(13-18)24(25,26)27)8-10-28-14-17-6-7-20-21(12-17)30-16-29-20/h3-7,12-13,28H,8-11,14-16H2,1-2H3/t23-/m1/s1 |
| InChIKey | NSPYYTLYXJEXFA-HSZRJFAPSA-N |
| XLogP | 5.44 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|