C23H37NO3 — CID 7091291
N-(1,3-benzodioxol-5-ylmethyl)-2-[(2R,4S)-2-ethyl-2-methyl-4-(3-methylbutyl)oxan-4-yl]ethanamine (PubChem CID 7091291) has the molecular formula C23H37NO3 and a molecular weight of 375.55 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[(2R,4S)-2-ethyl-2-methyl-4-(3-methylbutyl)oxan-4-yl]ethanamine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(2R,4S)-2-ethyl-2-methyl-4-(3-methylbutyl)oxan-4-yl]ethanamine |
|---|---|
| PubChem CID | 7091291 |
| Molecular Formula | C23H37NO3 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.28 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(2R,4S)-2-ethyl-2-methyl-4-(3-methylbutyl)oxan-4-yl]ethanamine |
| SMILES | CC[C@]1(C)C[C@](CCNCc2ccc3c(c2)OCO3)(CCC(C)C)CCO1 |
| InChI | InChI=1S/C23H37NO3/c1-5-22(4)16-23(11-13-27-22,9-8-18(2)3)10-12-24-15-19-6-7-20-21(14-19)26-17-25-20/h6-7,14,18,24H,5,8-13,15-17H2,1-4H3/t22-,23+/m1/s1 |
| InChIKey | APCKQTTXNMXHEO-PKTZIBPZSA-N |
| XLogP | 5.30 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|