C25H43NO2 — CID 7091208
2-[(2R,4S)-2-ethyl-2-methyl-4-(3-methylbutyl)oxan-4-yl]-N-[(4-propan-2-yloxyphenyl)methyl]ethanamine (PubChem CID 7091208) has the molecular formula C25H43NO2 and a molecular weight of 389.62 g/mol. Its IUPAC name is 2-[(2R,4S)-2-ethyl-2-methyl-4-(3-methylbutyl)oxan-4-yl]-N-[(4-propan-2-yloxyphenyl)methyl]ethanamine.
| Compound Name | 2-[(2R,4S)-2-ethyl-2-methyl-4-(3-methylbutyl)oxan-4-yl]-N-[(4-propan-2-yloxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 7091208 |
| Molecular Formula | C25H43NO2 |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 389.33 |
| IUPAC Name | 2-[(2R,4S)-2-ethyl-2-methyl-4-(3-methylbutyl)oxan-4-yl]-N-[(4-propan-2-yloxyphenyl)methyl]ethanamine |
| SMILES | CC[C@]1(C)C[C@](CCNCc2ccc(OC(C)C)cc2)(CCC(C)C)CCO1 |
| InChI | InChI=1S/C25H43NO2/c1-7-24(6)19-25(15-17-27-24,13-12-20(2)3)14-16-26-18-22-8-10-23(11-9-22)28-21(4)5/h8-11,20-21,26H,7,12-19H2,1-6H3/t24-,25+/m1/s1 |
| InChIKey | ZTDVYEQPAGWHGG-RPBOFIJWSA-N |
| XLogP | 6.36 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|