C25H35NO3 — CID 7077557
2-[(2R,4R)-2-ethyl-4-(4-methoxyphenyl)-2-methyloxan-4-yl]-N-[(4-methoxyphenyl)methyl]ethanamine (PubChem CID 7077557) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is 2-[(2R,4R)-2-ethyl-4-(4-methoxyphenyl)-2-methyloxan-4-yl]-N-[(4-methoxyphenyl)methyl]ethanamine.
| Compound Name | 2-[(2R,4R)-2-ethyl-4-(4-methoxyphenyl)-2-methyloxan-4-yl]-N-[(4-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 7077557 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 2-[(2R,4R)-2-ethyl-4-(4-methoxyphenyl)-2-methyloxan-4-yl]-N-[(4-methoxyphenyl)methyl]ethanamine |
| SMILES | CC[C@]1(C)C[C@](CCNCc2ccc(OC)cc2)(c2ccc(OC)cc2)CCO1 |
| InChI | InChI=1S/C25H35NO3/c1-5-24(2)19-25(15-17-29-24,21-8-12-23(28-4)13-9-21)14-16-26-18-20-6-10-22(27-3)11-7-20/h6-13,26H,5,14-19H2,1-4H3/t24-,25-/m1/s1 |
| InChIKey | RZCWUQPCGKDIRD-JWQCQUIFSA-N |
| XLogP | 5.10 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|