C20H34O2 — CID 176659697
2,4-diethyl-4-(4-methoxyphenyl)-2-methyloxane;propane (PubChem CID 176659697) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 2,4-diethyl-4-(4-methoxyphenyl)-2-methyloxane;propane.
| Compound Name | 2,4-diethyl-4-(4-methoxyphenyl)-2-methyloxane;propane |
|---|---|
| PubChem CID | 176659697 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 2,4-diethyl-4-(4-methoxyphenyl)-2-methyloxane;propane |
| SMILES | CCC.CCC1(C)CC(CC)(c2ccc(OC)cc2)CCO1 |
| InChI | InChI=1S/C17H26O2.C3H8/c1-5-16(3)13-17(6-2,11-12-19-16)14-7-9-15(18-4)10-8-14;1-3-2/h7-10H,5-6,11-13H2,1-4H3;3H2,1-2H3 |
| InChIKey | FRGBJQXLEUXBAO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |