C17H23O4- — CID 6948997
2-[(2S,4S)-2-ethyl-4-(4-methoxyphenyl)-2-methyloxan-4-yl]acetate (PubChem CID 6948997) has the molecular formula C17H23O4- and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-[(2S,4S)-2-ethyl-4-(4-methoxyphenyl)-2-methyloxan-4-yl]acetate.
| Compound Name | 2-[(2S,4S)-2-ethyl-4-(4-methoxyphenyl)-2-methyloxan-4-yl]acetate |
|---|---|
| PubChem CID | 6948997 |
| Molecular Formula | C17H23O4- |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-[(2S,4S)-2-ethyl-4-(4-methoxyphenyl)-2-methyloxan-4-yl]acetate |
| SMILES | CC[C@@]1(C)C[C@@](CC(=O)[O-])(c2ccc(OC)cc2)CCO1 |
| InChI | InChI=1S/C17H24O4/c1-4-16(2)12-17(9-10-21-16,11-15(18)19)13-5-7-14(20-3)8-6-13/h5-8H,4,9-12H2,1-3H3,(H,18,19)/p-1/t16-,17+/m0/s1 |
| InChIKey | HLGMPFVKTVGBFG-DLBZAZTESA-M |
| XLogP | 2.05 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |