C27H36FNO3 — CID 125433404
N-(1,3-benzodioxol-5-ylmethyl)-2-[(2R,6R)-4-(4-fluorophenyl)-2,6-di(propan-2-yl)oxan-4-yl]ethanamine (PubChem CID 125433404) has the molecular formula C27H36FNO3 and a molecular weight of 441.59 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[(2R,6R)-4-(4-fluorophenyl)-2,6-di(propan-2-yl)oxan-4-yl]ethanamine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(2R,6R)-4-(4-fluorophenyl)-2,6-di(propan-2-yl)oxan-4-yl]ethanamine |
|---|---|
| PubChem CID | 125433404 |
| Molecular Formula | C27H36FNO3 |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(2R,6R)-4-(4-fluorophenyl)-2,6-di(propan-2-yl)oxan-4-yl]ethanamine |
| SMILES | CC(C)[C@H]1CC(CCNCc2ccc3c(c2)OCO3)(c2ccc(F)cc2)C[C@H](C(C)C)O1 |
| InChI | InChI=1S/C27H36FNO3/c1-18(2)25-14-27(15-26(32-25)19(3)4,21-6-8-22(28)9-7-21)11-12-29-16-20-5-10-23-24(13-20)31-17-30-23/h5-10,13,18-19,25-26,29H,11-12,14-17H2,1-4H3/t25-,26-/m1/s1 |
| InChIKey | FPOYKKRDKDJKOG-CLJLJLNGSA-N |
| XLogP | 5.83 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|