C19H29NO3 — CID 125433840
(2R,6R)-N-(1,3-benzodioxol-5-ylmethyl)-2,6-di(propan-2-yl)oxan-4-amine (PubChem CID 125433840) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is (2R,6R)-N-(1,3-benzodioxol-5-ylmethyl)-2,6-di(propan-2-yl)oxan-4-amine.
| Compound Name | (2R,6R)-N-(1,3-benzodioxol-5-ylmethyl)-2,6-di(propan-2-yl)oxan-4-amine |
|---|---|
| PubChem CID | 125433840 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (2R,6R)-N-(1,3-benzodioxol-5-ylmethyl)-2,6-di(propan-2-yl)oxan-4-amine |
| SMILES | CC(C)[C@H]1CC(NCc2ccc3c(c2)OCO3)C[C@H](C(C)C)O1 |
| InChI | InChI=1S/C19H29NO3/c1-12(2)17-8-15(9-18(23-17)13(3)4)20-10-14-5-6-16-19(7-14)22-11-21-16/h5-7,12-13,15,17-18,20H,8-11H2,1-4H3/t17-,18-/m1/s1 |
| InChIKey | QFCSLHUPMINKGK-QZTJIDSGSA-N |
| XLogP | 3.73 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |