C12H15NO4S — CID 43087894
N-(1,3-benzodioxol-5-ylmethyl)-1,1-dioxothiolan-3-amine (PubChem CID 43087894) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-1,1-dioxothiolan-3-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 43087894 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CCC(NCc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C12H15NO4S/c14-18(15)4-3-10(7-18)13-6-9-1-2-11-12(5-9)17-8-16-11/h1-2,5,10,13H,3-4,6-8H2 |
| InChIKey | JFFLNAPKCRTMON-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |