C15H22FNO — CID 753864
2-[(4S)-4-(4-fluorophenyl)-2,2-dimethyloxan-4-yl]ethanamine (PubChem CID 753864) has the molecular formula C15H22FNO and a molecular weight of 251.34 g/mol. Its IUPAC name is 2-[(4S)-4-(4-fluorophenyl)-2,2-dimethyloxan-4-yl]ethanamine.
| Compound Name | 2-[(4S)-4-(4-fluorophenyl)-2,2-dimethyloxan-4-yl]ethanamine |
|---|---|
| PubChem CID | 753864 |
| Molecular Formula | C15H22FNO |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-[(4S)-4-(4-fluorophenyl)-2,2-dimethyloxan-4-yl]ethanamine |
| SMILES | CC1(C)C[C@@](CCN)(c2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C15H22FNO/c1-14(2)11-15(7-9-17,8-10-18-14)12-3-5-13(16)6-4-12/h3-6H,7-11,17H2,1-2H3/t15-/m0/s1 |
| InChIKey | LHTXAUZHTWDXMN-HNNXBMFYSA-N |
| XLogP | 3.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |