C24H34NO2+ — CID 7102245
benzyl-[2-[(2S,4S)-2-ethyl-4-(2-methoxyphenyl)-2-methyloxan-4-yl]ethyl]azanium (PubChem CID 7102245) has the molecular formula C24H34NO2+ and a molecular weight of 368.54 g/mol. Its IUPAC name is benzyl-[2-[(2S,4S)-2-ethyl-4-(2-methoxyphenyl)-2-methyloxan-4-yl]ethyl]azanium.
| Compound Name | benzyl-[2-[(2S,4S)-2-ethyl-4-(2-methoxyphenyl)-2-methyloxan-4-yl]ethyl]azanium |
|---|---|
| PubChem CID | 7102245 |
| Molecular Formula | C24H34NO2+ |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | benzyl-[2-[(2S,4S)-2-ethyl-4-(2-methoxyphenyl)-2-methyloxan-4-yl]ethyl]azanium |
| SMILES | CC[C@@]1(C)C[C@@](CC[NH2+]Cc2ccccc2)(c2ccccc2OC)CCO1 |
| InChI | InChI=1S/C24H33NO2/c1-4-23(2)19-24(15-17-27-23,21-12-8-9-13-22(21)26-3)14-16-25-18-20-10-6-5-7-11-20/h5-13,25H,4,14-19H2,1-3H3/p+1/t23-,24-/m0/s1 |
| InChIKey | ZDVSWFOKMBUCNJ-ZEQRLZLVSA-O |
| XLogP | 4.07 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|