C26H38NO4+ — CID 7639709
(3,4-dimethoxyphenyl)methyl-[2-[(2R,4S)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethyl]azanium (PubChem CID 7639709) has the molecular formula C26H38NO4+ and a molecular weight of 428.59 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methyl-[2-[(2R,4S)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethyl]azanium.
| Compound Name | (3,4-dimethoxyphenyl)methyl-[2-[(2R,4S)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethyl]azanium |
|---|---|
| PubChem CID | 7639709 |
| Molecular Formula | C26H38NO4+ |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | (3,4-dimethoxyphenyl)methyl-[2-[(2R,4S)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethyl]azanium |
| SMILES | COc1ccc(C[NH2+]CC[C@]2(c3ccccc3OC)CCO[C@@H](C(C)C)C2)cc1OC |
| InChI | InChI=1S/C26H37NO4/c1-19(2)25-17-26(13-15-31-25,21-8-6-7-9-22(21)28-3)12-14-27-18-20-10-11-23(29-4)24(16-20)30-5/h6-11,16,19,25,27H,12-15,17-18H2,1-5H3/p+1/t25-,26+/m1/s1 |
| InChIKey | OLCUFNQLHQAXSR-FTJBHMTQSA-O |
| XLogP | 3.94 |
| TPSA | 53.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|