C29H42N2O3 — CID 40927445
N-[[4-(dimethylamino)phenyl]methyl]-N-[2-[(2R,4R)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethyl]propanamide (PubChem CID 40927445) has the molecular formula C29H42N2O3 and a molecular weight of 466.67 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-[2-[(2R,4R)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethyl]propanamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[2-[(2R,4R)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 40927445 |
| Molecular Formula | C29H42N2O3 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.32 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[2-[(2R,4R)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethyl]propanamide |
| SMILES | CCC(=O)N(CC[C@@]1(c2ccccc2OC)CCO[C@@H](C(C)C)C1)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C29H42N2O3/c1-7-28(32)31(21-23-12-14-24(15-13-23)30(4)5)18-16-29(17-19-34-27(20-29)22(2)3)25-10-8-9-11-26(25)33-6/h8-15,22,27H,7,16-21H2,1-6H3/t27-,29-/m1/s1 |
| InChIKey | NUNZVQCWCLIKRE-XRKRLSELSA-N |
| XLogP | 5.66 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|