C22H31NO3 — CID 7082816
N-(furan-2-ylmethyl)-2-[(2R,4S)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethanamine (PubChem CID 7082816) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(2R,4S)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethanamine.
| Compound Name | N-(furan-2-ylmethyl)-2-[(2R,4S)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethanamine |
|---|---|
| PubChem CID | 7082816 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(2R,4S)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethanamine |
| SMILES | COc1ccccc1[C@@]1(CCNCc2ccco2)CCO[C@@H](C(C)C)C1 |
| InChI | InChI=1S/C22H31NO3/c1-17(2)21-15-22(11-14-26-21,19-8-4-5-9-20(19)24-3)10-12-23-16-18-7-6-13-25-18/h4-9,13,17,21,23H,10-12,14-16H2,1-3H3/t21-,22+/m1/s1 |
| InChIKey | RRBSQXXIPSHAEE-YADHBBJMSA-N |
| XLogP | 4.54 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|