C22H31NO2 — CID 40917194
2-[(2S,4S)-4-benzyl-2-propan-2-yloxan-4-yl]-N-(furan-2-ylmethyl)ethanamine (PubChem CID 40917194) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-[(2S,4S)-4-benzyl-2-propan-2-yloxan-4-yl]-N-(furan-2-ylmethyl)ethanamine.
| Compound Name | 2-[(2S,4S)-4-benzyl-2-propan-2-yloxan-4-yl]-N-(furan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 40917194 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | 2-[(2S,4S)-4-benzyl-2-propan-2-yloxan-4-yl]-N-(furan-2-ylmethyl)ethanamine |
| SMILES | CC(C)[C@@H]1C[C@](CCNCc2ccco2)(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C22H31NO2/c1-18(2)21-16-22(11-14-25-21,15-19-7-4-3-5-8-19)10-12-23-17-20-9-6-13-24-20/h3-9,13,18,21,23H,10-12,14-17H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | FTYLBMAHZDXPAM-VXKWHMMOSA-N |
| XLogP | 4.82 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|