C23H30N2O2 — CID 41064666
2-[(2R,4R)-4-benzyl-2-propan-2-yloxan-4-yl]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 41064666) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-[(2R,4R)-4-benzyl-2-propan-2-yloxan-4-yl]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[(2R,4R)-4-benzyl-2-propan-2-yloxan-4-yl]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 41064666 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-[(2R,4R)-4-benzyl-2-propan-2-yloxan-4-yl]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | CC(C)[C@H]1C[C@@](CC(=O)NCc2cccnc2)(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C23H30N2O2/c1-18(2)21-14-23(10-12-27-21,13-19-7-4-3-5-8-19)15-22(26)25-17-20-9-6-11-24-16-20/h3-9,11,16,18,21H,10,12-15,17H2,1-2H3,(H,25,26)/t21-,23+/m1/s1 |
| InChIKey | ZLVSCYXXHREPGG-GGAORHGYSA-N |
| XLogP | 4.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |