C23H30FNO — CID 7122733
N-[(2-fluorophenyl)methyl]-2-[(2S,4R)-4-phenyl-2-propan-2-yloxan-4-yl]ethanamine (PubChem CID 7122733) has the molecular formula C23H30FNO and a molecular weight of 355.50 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2-[(2S,4R)-4-phenyl-2-propan-2-yloxan-4-yl]ethanamine.
| Compound Name | N-[(2-fluorophenyl)methyl]-2-[(2S,4R)-4-phenyl-2-propan-2-yloxan-4-yl]ethanamine |
|---|---|
| PubChem CID | 7122733 |
| Molecular Formula | C23H30FNO |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2-[(2S,4R)-4-phenyl-2-propan-2-yloxan-4-yl]ethanamine |
| SMILES | CC(C)[C@@H]1C[C@](CCNCc2ccccc2F)(c2ccccc2)CCO1 |
| InChI | InChI=1S/C23H30FNO/c1-18(2)22-16-23(13-15-26-22,20-9-4-3-5-10-20)12-14-25-17-19-8-6-7-11-21(19)24/h3-11,18,22,25H,12-17H2,1-2H3/t22-,23+/m0/s1 |
| InChIKey | MSNDYHDGMIZQPJ-XZOQPEGZSA-N |
| XLogP | 5.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|