C21H34NO+ — CID 6981772
1-[2-[(2S,4R)-4-phenyl-2-propan-2-yloxan-4-yl]ethyl]piperidin-1-ium (PubChem CID 6981772) has the molecular formula C21H34NO+ and a molecular weight of 316.51 g/mol. Its IUPAC name is 1-[2-[(2S,4R)-4-phenyl-2-propan-2-yloxan-4-yl]ethyl]piperidin-1-ium.
| Compound Name | 1-[2-[(2S,4R)-4-phenyl-2-propan-2-yloxan-4-yl]ethyl]piperidin-1-ium |
|---|---|
| PubChem CID | 6981772 |
| Molecular Formula | C21H34NO+ |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 1-[2-[(2S,4R)-4-phenyl-2-propan-2-yloxan-4-yl]ethyl]piperidin-1-ium |
| SMILES | CC(C)[C@@H]1C[C@](CC[NH+]2CCCCC2)(c2ccccc2)CCO1 |
| InChI | InChI=1S/C21H33NO/c1-18(2)20-17-21(12-16-23-20,19-9-5-3-6-10-19)11-15-22-13-7-4-8-14-22/h3,5-6,9-10,18,20H,4,7-8,11-17H2,1-2H3/p+1/t20-,21+/m0/s1 |
| InChIKey | UFMQWLIDSQXQNS-LEWJYISDSA-O |
| XLogP | 3.22 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |