C16H26NO+ — CID 7350813
2-[(2S,4S)-4-phenyl-2-propan-2-yloxan-4-yl]ethylazanium (PubChem CID 7350813) has the molecular formula C16H26NO+ and a molecular weight of 248.39 g/mol. Its IUPAC name is 2-[(2S,4S)-4-phenyl-2-propan-2-yloxan-4-yl]ethylazanium.
| Compound Name | 2-[(2S,4S)-4-phenyl-2-propan-2-yloxan-4-yl]ethylazanium |
|---|---|
| PubChem CID | 7350813 |
| Molecular Formula | C16H26NO+ |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 2-[(2S,4S)-4-phenyl-2-propan-2-yloxan-4-yl]ethylazanium |
| SMILES | CC(C)[C@@H]1C[C@@](CC[NH3+])(c2ccccc2)CCO1 |
| InChI | InChI=1S/C16H25NO/c1-13(2)15-12-16(8-10-17,9-11-18-15)14-6-4-3-5-7-14/h3-7,13,15H,8-12,17H2,1-2H3/p+1/t15-,16-/m0/s1 |
| InChIKey | WOJVWLYVRMDBAB-HOTGVXAUSA-O |
| XLogP | 2.39 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |