C21H30NO2+ — CID 6995808
furan-2-ylmethyl-[2-[(2R,4R)-4-phenyl-2-propan-2-yloxan-4-yl]ethyl]azanium (PubChem CID 6995808) has the molecular formula C21H30NO2+ and a molecular weight of 328.48 g/mol. Its IUPAC name is furan-2-ylmethyl-[2-[(2R,4R)-4-phenyl-2-propan-2-yloxan-4-yl]ethyl]azanium.
| Compound Name | furan-2-ylmethyl-[2-[(2R,4R)-4-phenyl-2-propan-2-yloxan-4-yl]ethyl]azanium |
|---|---|
| PubChem CID | 6995808 |
| Molecular Formula | C21H30NO2+ |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | furan-2-ylmethyl-[2-[(2R,4R)-4-phenyl-2-propan-2-yloxan-4-yl]ethyl]azanium |
| SMILES | CC(C)[C@H]1C[C@](CC[NH2+]Cc2ccco2)(c2ccccc2)CCO1 |
| InChI | InChI=1S/C21H29NO2/c1-17(2)20-15-21(11-14-24-20,18-7-4-3-5-8-18)10-12-22-16-19-9-6-13-23-19/h3-9,13,17,20,22H,10-12,14-16H2,1-2H3/p+1/t20-,21-/m1/s1 |
| InChIKey | UMCUDUUEJCLEGK-NHCUHLMSSA-O |
| XLogP | 3.51 |
| TPSA | 38.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|