C24H32FNO2 — CID 7460939
N-[(2-fluorophenyl)methyl]-2-[(2R,4R)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethanamine (PubChem CID 7460939) has the molecular formula C24H32FNO2 and a molecular weight of 385.52 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2-[(2R,4R)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethanamine.
| Compound Name | N-[(2-fluorophenyl)methyl]-2-[(2R,4R)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethanamine |
|---|---|
| PubChem CID | 7460939 |
| Molecular Formula | C24H32FNO2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2-[(2R,4R)-4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]ethanamine |
| SMILES | COc1ccccc1[C@]1(CCNCc2ccccc2F)CCO[C@@H](C(C)C)C1 |
| InChI | InChI=1S/C24H32FNO2/c1-18(2)23-16-24(13-15-28-23,20-9-5-7-11-22(20)27-3)12-14-26-17-19-8-4-6-10-21(19)25/h4-11,18,23,26H,12-17H2,1-3H3/t23-,24-/m1/s1 |
| InChIKey | KCYOBLYWPXGPGW-DNQXCXABSA-N |
| XLogP | 5.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|